WO2004082592A2 - Metal amino acid chelates having nutritionally relevant anion radical (s) - Google Patents
Metal amino acid chelates having nutritionally relevant anion radical (s) Download PDFInfo
- Publication number
- WO2004082592A2 WO2004082592A2 PCT/IN2004/000063 IN2004000063W WO2004082592A2 WO 2004082592 A2 WO2004082592 A2 WO 2004082592A2 IN 2004000063 W IN2004000063 W IN 2004000063W WO 2004082592 A2 WO2004082592 A2 WO 2004082592A2
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- amino acid
- metal
- nutritionally relevant
- radical
- alpha amino
- Prior art date
Links
- 229910052751 metal Inorganic materials 0.000 title claims abstract description 98
- 239000002184 metal Substances 0.000 title claims abstract description 98
- 150000001413 amino acids Chemical class 0.000 title claims abstract description 96
- 239000013522 chelant Substances 0.000 claims abstract description 68
- 239000002253 acid Substances 0.000 claims abstract description 39
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims abstract description 18
- -1 Amino Acid Hydroxide Chemical class 0.000 claims abstract description 14
- 238000010521 absorption reaction Methods 0.000 claims abstract description 14
- 238000000034 method Methods 0.000 claims abstract description 13
- 238000010494 dissociation reaction Methods 0.000 claims abstract description 5
- 230000005593 dissociations Effects 0.000 claims abstract description 5
- 229940024606 amino acid Drugs 0.000 claims description 107
- 235000001014 amino acid Nutrition 0.000 claims description 103
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 claims description 71
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 69
- 235000008206 alpha-amino acids Nutrition 0.000 claims description 45
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 claims description 43
- 235000010323 ascorbic acid Nutrition 0.000 claims description 35
- 239000011668 ascorbic acid Substances 0.000 claims description 35
- 229910052742 iron Inorganic materials 0.000 claims description 34
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 29
- 229910021645 metal ion Inorganic materials 0.000 claims description 18
- 230000015572 biosynthetic process Effects 0.000 claims description 16
- 238000004519 manufacturing process Methods 0.000 claims description 16
- 239000004471 Glycine Substances 0.000 claims description 14
- 229940072107 ascorbate Drugs 0.000 claims description 14
- 150000002500 ions Chemical class 0.000 claims description 14
- 150000001450 anions Chemical class 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000000047 product Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000004429 atom Chemical group 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 claims description 6
- 230000009920 chelation Effects 0.000 claims description 6
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 claims description 6
- 229930182817 methionine Natural products 0.000 claims description 6
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 6
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 5
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- 239000011575 calcium Substances 0.000 claims description 5
- 235000019152 folic acid Nutrition 0.000 claims description 5
- 239000011724 folic acid Substances 0.000 claims description 5
- 235000013305 food Nutrition 0.000 claims description 5
- 230000001965 increasing effect Effects 0.000 claims description 5
- 150000002739 metals Chemical class 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- 229910002651 NO3 Inorganic materials 0.000 claims description 4
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052791 calcium Inorganic materials 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- 229940014144 folate Drugs 0.000 claims description 4
- 239000011777 magnesium Substances 0.000 claims description 4
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims description 4
- 235000001968 nicotinic acid Nutrition 0.000 claims description 4
- 239000011664 nicotinic acid Substances 0.000 claims description 4
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 claims description 3
- 239000004475 Arginine Substances 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- LEVWYRKDKASIDU-QWWZWVQMSA-N D-cystine Chemical compound OC(=O)[C@H](N)CSSC[C@@H](N)C(O)=O LEVWYRKDKASIDU-QWWZWVQMSA-N 0.000 claims description 3
- 108010016626 Dipeptides Proteins 0.000 claims description 3
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 claims description 3
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 claims description 3
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 claims description 3
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 claims description 3
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 claims description 3
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 claims description 3
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 claims description 3
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 claims description 3
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 claims description 3
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 claims description 3
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 claims description 3
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 claims description 3
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 claims description 3
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 claims description 3
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 claims description 3
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 claims description 3
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 claims description 3
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 claims description 3
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 claims description 3
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 claims description 3
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 claims description 3
- 239000004472 Lysine Substances 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- WACCUYFNPQUOJO-ZZMNMWMASA-N O=C1C(O)=C(O)[C@H](O1)[C@@H](O)CO.O=C1C(O)=C(O)[C@H](O1)[C@@H](O)CO.NCC(=O)O Chemical compound O=C1C(O)=C(O)[C@H](O1)[C@@H](O)CO.O=C1C(O)=C(O)[C@H](O1)[C@@H](O)CO.NCC(=O)O WACCUYFNPQUOJO-ZZMNMWMASA-N 0.000 claims description 3
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 claims description 3
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 claims description 3
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 claims description 3
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 claims description 3
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 claims description 3
- 239000004473 Threonine Substances 0.000 claims description 3
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 claims description 3
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 claims description 3
- 235000004279 alanine Nutrition 0.000 claims description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 claims description 3
- 235000009697 arginine Nutrition 0.000 claims description 3
- 235000009582 asparagine Nutrition 0.000 claims description 3
- 235000003704 aspartic acid Nutrition 0.000 claims description 3
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 claims description 3
- 235000018417 cysteine Nutrition 0.000 claims description 3
- 229960003067 cystine Drugs 0.000 claims description 3
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 claims description 3
- 235000013922 glutamic acid Nutrition 0.000 claims description 3
- 239000004220 glutamic acid Substances 0.000 claims description 3
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 claims description 3
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 3
- 229960002591 hydroxyproline Drugs 0.000 claims description 3
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 claims description 3
- 229960000310 isoleucine Drugs 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 229960003104 ornithine Drugs 0.000 claims description 3
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 claims description 3
- FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 claims description 3
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 claims description 3
- 239000004474 valine Substances 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 claims description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 claims description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 claims description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- YBJHBAHKTGYVGT-ZKWXMUAHSA-M biotinate Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)[O-])SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-M 0.000 claims description 2
- 238000001035 drying Methods 0.000 claims description 2
- 239000006052 feed supplement Substances 0.000 claims description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical compound [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 claims description 2
- 229940050410 gluconate Drugs 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 229940049920 malate Drugs 0.000 claims description 2
- 235000016709 nutrition Nutrition 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 235000019629 palatability Nutrition 0.000 claims description 2
- 239000002994 raw material Substances 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 2
- 229940095064 tartrate Drugs 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims 2
- 239000007864 aqueous solution Substances 0.000 claims 2
- 239000003125 aqueous solvent Substances 0.000 claims 2
- 150000001508 asparagines Chemical class 0.000 claims 2
- 239000003446 ligand Substances 0.000 claims 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 2
- 239000000243 solution Substances 0.000 claims 2
- 239000011701 zinc Substances 0.000 claims 2
- 229910052725 zinc Inorganic materials 0.000 claims 2
- ZILKSHRRLQSVCP-ODXUFZIJSA-L (2S)-2-amino-4-methylsulfanylbutanoic acid (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-olate iron(2+) Chemical compound O=C1C(O)=C([O-])[C@H](O1)[C@@H](O)CO.O=C1C(O)=C([O-])[C@H](O1)[C@@H](O)CO.N[C@@H](CCSC)C(=O)O.N[C@@H](CCSC)C(=O)O.[Fe+2] ZILKSHRRLQSVCP-ODXUFZIJSA-L 0.000 claims 1
- KDLLAIYWORQMSN-WCCKRBBISA-N (2s)-2-amino-4-methylsulfanylbutanoic acid;iron Chemical compound [Fe].CSCC[C@H](N)C(O)=O KDLLAIYWORQMSN-WCCKRBBISA-N 0.000 claims 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 claims 1
- 208000025371 Taste disease Diseases 0.000 claims 1
- 235000020971 citrus fruits Nutrition 0.000 claims 1
- 230000001747 exhibiting effect Effects 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- ODBLHEXUDAPZAU-UHFFFAOYSA-N isocitric acid Chemical compound OC(=O)C(O)C(C(O)=O)CC(O)=O ODBLHEXUDAPZAU-UHFFFAOYSA-N 0.000 claims 1
- 235000019656 metallic taste Nutrition 0.000 claims 1
- 229920001184 polypeptide Polymers 0.000 claims 1
- 102000004196 processed proteins & peptides Human genes 0.000 claims 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 13
- 125000003275 alpha amino acid group Chemical group 0.000 abstract description 2
- 229960005070 ascorbic acid Drugs 0.000 description 22
- 229910052500 inorganic mineral Inorganic materials 0.000 description 11
- 239000011707 mineral Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 6
- ZHUXMBYIONRQQX-UHFFFAOYSA-N hydroxidodioxidocarbon(.) Chemical compound [O]C(O)=O ZHUXMBYIONRQQX-UHFFFAOYSA-N 0.000 description 5
- 235000012054 meals Nutrition 0.000 description 5
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 239000003623 enhancer Substances 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 3
- OTTPVANZKZRSBY-UHFFFAOYSA-N 2-aminoacetic acid;iron Chemical compound [Fe].NCC(O)=O.NCC(O)=O OTTPVANZKZRSBY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- 235000015165 citric acid Nutrition 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000013589 supplement Substances 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical class OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000000378 dietary effect Effects 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 150000002505 iron Chemical class 0.000 description 2
- 235000020796 iron status Nutrition 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 229940099690 malic acid Drugs 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 230000000050 nutritive effect Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 235000002949 phytic acid Nutrition 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 235000018553 tannin Nutrition 0.000 description 2
- 229920001864 tannin Polymers 0.000 description 2
- 239000001648 tannin Substances 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Natural products OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 240000006432 Carica papaya Species 0.000 description 1
- 235000009467 Carica papaya Nutrition 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 206010013911 Dysgeusia Diseases 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-N Gluconic acid Natural products OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 102000001554 Hemoglobins Human genes 0.000 description 1
- 108010054147 Hemoglobins Proteins 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 1
- 206010028813 Nausea Diseases 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 206010000059 abdominal discomfort Diseases 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009056 active transport Effects 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 208000007502 anemia Diseases 0.000 description 1
- 229960001230 asparagine Drugs 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000013361 beverage Nutrition 0.000 description 1
- 229960002685 biotin Drugs 0.000 description 1
- 235000020958 biotin Nutrition 0.000 description 1
- 239000011616 biotin Substances 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- VILAVOFMIJHSJA-UHFFFAOYSA-N dicarbon monoxide Chemical compound [C]=C=O VILAVOFMIJHSJA-UHFFFAOYSA-N 0.000 description 1
- 235000015872 dietary supplement Nutrition 0.000 description 1
- 210000002249 digestive system Anatomy 0.000 description 1
- SWIRFWUEJODNRG-LTCKWSDVSA-L disodium;(2s)-2-[[4-[(2-amino-4-oxo-1h-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioate Chemical compound [Na+].[Na+].C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)C=C1 SWIRFWUEJODNRG-LTCKWSDVSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000009313 farming Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 229960000304 folic acid Drugs 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229940116298 l- malic acid Drugs 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 150000001455 metallic ions Chemical group 0.000 description 1
- 239000002366 mineral element Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000008693 nausea Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229940068196 placebo Drugs 0.000 description 1
- 239000000902 placebo Substances 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229930002330 retinoic acid Natural products 0.000 description 1
- 229940000207 selenious acid Drugs 0.000 description 1
- MCAHWIHFGHIESP-UHFFFAOYSA-N selenous acid Chemical compound O[Se](O)=O MCAHWIHFGHIESP-UHFFFAOYSA-N 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 229960002098 sodium folate Drugs 0.000 description 1
- ZTYOEHTVHXWFJT-YDALLXLXSA-M sodium;(4s)-4-[[4-[(2-amino-4-oxo-1h-pteridin-6-yl)methylamino]benzoyl]amino]-5-hydroxy-5-oxopentanoate Chemical compound [Na+].C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C([O-])=O)C=C1 ZTYOEHTVHXWFJT-YDALLXLXSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- JBQYATWDVHIOAR-UHFFFAOYSA-N tellanylidenegermanium Chemical compound [Te]=[Ge] JBQYATWDVHIOAR-UHFFFAOYSA-N 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/76—Metal complexes of amino carboxylic acids
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23L—FOODS, FOODSTUFFS, OR NON-ALCOHOLIC BEVERAGES, NOT COVERED BY SUBCLASSES A21D OR A23B-A23J; THEIR PREPARATION OR TREATMENT, e.g. COOKING, MODIFICATION OF NUTRITIVE QUALITIES, PHYSICAL TREATMENT; PRESERVATION OF FOODS OR FOODSTUFFS, IN GENERAL
- A23L33/00—Modifying nutritive qualities of foods; Dietetic products; Preparation or treatment thereof
- A23L33/10—Modifying nutritive qualities of foods; Dietetic products; Preparation or treatment thereof using additives
- A23L33/17—Amino acids, peptides or proteins
Definitions
- This invention lays emphasis on formation of metal alpha amino acid chelate, wherein the primary valency, if any and secondary valency of the metal is satisfied by amino acid(s) and normally highly soluble quarternary ammonium salt formed by the coordinate covalent bonding of the 'N' of amino acid group with nutritionally relevant anion radical(s).
- This invention also includes chelates formed with the charge on the metal 1)0 ion being neutralized by amino acid(s) along with negatively charged elements / groups, the resultant products forming quarternary ammonium complex with nutritionally relevant anion radical(s) as mentioned above.
- the composition is prepared by reacting a metal Amino Acid Hydroxide Chelate or Metal Amino Acid Salt Chelate with a nutritionally relevant acid radical in a suitable mole ratio such that the new chelate formed has the metal Amino Acid structure is unchanged but is bonded to a nutritionally relevant Anion
- Amino Acid Chelates having a nutritionally relevant anion radical are those chelates which have the metal linked to the Amino Acid having a positive charge and the Nutritionally relevant Radical having the negative charge when ionized.
- the metal amino acid chelates of the present invention have a amino acid to metal to Nutritionally relevant Acid Radical in a molar ratio from 1 :1 :1 to 4:1 :2.
- Amino acid chelates are generally produced by the reaction between .alpha.-amino acids and metal ions having a valency of two or more to form a ring structure.
- the positive electrical charge of the metal ion is neutralized by the electrons available through the carboxylate or free amino groups of the .alpha.-amino acid.
- chelate has been loosely defined as a combination of a metallic ion bonded to one or more amino acids forming heterocyclic ring structures. Under this definition, chelate formation through neutralization of the positive charges of the metal ions may be through the formation of ionic, covalent, or coordinate covalent bonding.
- I S A chelate is a definite structure resulting from precise requirement of synthesis. Proper conditions must be present for chelation to take place, including proper mole ratios of amino acids to metal ions, pH, temperature, solubility of reactants and proper catalysts. For chelation to occur, all components are generally dissolved in solution and are either
- the product when properly formed, is a stable product having one or more five-membered rings formed by a reaction between the carboxyl oxygen, and the .alpha.-amino group of an .alpha.-amino acid with the metal or metal ion having a positive charge and an nutritionally relevant radical with a negative charge.
- an amino acid chelate when properly formed, is a stable product having one or more five-membered rings formed by a reaction between the carboxyl oxygen, and the .alpha.-amino group of an .alpha.-amino acid with the metal or metal ion having a positive charge and an nutritionally relevant radical with a negative charge.
- Such a five-membered ring is defined by the metal atom / ion, the carboxyl oxygen, the carbonyl carbon, the alpha carbon and the .alpha.- amino nitrogen.
- the alpha amino nitrogen denotes a lone pair to the metal ion. It was also surprisingly found that there existing a weak bond between the metal and quarternary alpha amino nitrogen.
- the actual structure of the cation will depend upon the amino acid to metal mole ratio and whether the carboxyl oxygen forms a coordinate covalent bond or an ionic bond with the metal ion.
- the amino acid to metal molar ratio is at least 1:1 and is preferably 2:1 or 3:1. However, in certain instances, the ratio may be 4:1.
- an amino acid chelate may be represented at a amino acid to metal molar ratio of 2:1.
- the nutritionally relevant anion radicals are formed from an acid with a stoichmetry of atleast one mole, typically two moles and in rare cases upto four moles.
- the structure of the Metal o amino acid chelate having nutritionally relevant anion radical is presented below.
- the solid lines represent coordinate covalent bonds and covalent bonds.
- the dashed lines between the alpha.-amino group and the metal (M) represent the weak bond.
- R is H
- the amino acid is glycine which is the simplest of the .alpha.-amino acids.
- R could be a radical forming any other of the other twenty or so naturally occurring amino acids derived from proteins. All of the amino acids have the same configuration for the positioning of the carboxyl oxygen and the .alpha.-amino nitrogen with respect to the metal ion.
- the chelate ring is defined by the same atoms with respect to all alpha amino acids in each instance, even though the R group may vary.
- the average molecular weight of the hydrolyzed Protein and / or amino acids must be approximately 150 and the resulting molecular weight of the chelate must not exceed 800.
- a metal atom / ion can accept bonds over and above the oxidation state of the metal is due to the nature of chelation.
- the nitrogen contributes both of the electrons used in the bonding. These electrons fill available spaces in the d-orbitals forming a coordinate covalent bond.
- a metal ion with a normal valency of +2 can be bonded by four bonds when fully chelated.
- the metal ion is typically bonded to the .alpha.-amino group by coordinate covalent bond and weak bond as mentioned above.
- the amino acid chelates can also be prepared using small peptide amino acids wherein the peptide may be in the form of dipeptides, tripeptides, and sometimes tetrapeptides.
- One advantage of amino acid chelates in the field of mineral nutrition is attributed to the fact that these chelates are readily absorbed in the absorptive mucosal cells or plant cells by means of active transport or other know mechanisms. In other words, the minerals are absorbed along with the amino acids as a single unit utilizing the amino acids as carrier molecules.
- Ascorbic Acid a unique acid which does not contain the carboxylic acid o group in its ring structure, is a strong enhancer of iron absorption. It may exert its "enhancing" effect by promoting acidic conditions within the stomach so that the dietary iron is efficiently solubilized; by reducing ferric iron to its better absorbed ferrous form; by forming chelates with iron in the stomach; and by maintaining the solubility of iron when the food 5 enters the alkaline environment of the small intestine - which counteracts the inhibitory effect of dietary amino acids such as phytates and tannins.
- Iron absorption from a semisynthetic meal increased three-fold after adding 75 mg ascorbic acid and four fold after adding 100 mg ascorbic acid (Cook and Monsen 1977; Monsen 1988; Reddy and Cook 1991). Adding 15 mg ascorbic acid caused a three fold increase in iron absorption from a rice porridge meal (Gillooly et al 1983). Studies with maize meals have shown a six fold increase in iron absorption with 150 g papaya containing 65 mg ascorbic acid (Layrisse et al. 1974), to a ten fold increase with 50 or 100 mg ascorbic acid (Derman et al, 1977).
- Ascorbic acid can improve iron absorption even in the presence of inhibitors such as phytates in cereals and soya, tannins in tea and calcium.
- inhibitors such as phytates in cereals and soya, tannins in tea and calcium.
- 54 anemic preschool children were supplemented with 100 mg synthetic ascorbic acid versus a placebo, at each of the two main meals, for two months (seshadri et al. 1985).
- Organic acids such as citric acid, malic acid, tartaric acid and lactic acid also enhances iron absorption (Derman et al. 1980; Gillooly et al. 1983; Ballot et al. 1987).
- the geometric mean iron absorption form a rice meal increased significantly with the addition of 1 g citric acid (by 3 fold) 1 g L- malic acid (by 2 fold) and 1 g tartaric acid (by 2.3 fold) (Gillooly et al. 1983).
- US Patent Nos.4067994, 4599152, 4830716, 5516925, 6166071, 5 6426424, 6458981 , 6518240 6541051 relates to method of manufacture of an amino acid chelates.
- Our invention relates to the charge on the metal totally neutralised by the carboxylic acid group of the alpha amino acid forming a chelate and 5 the resulting chelate is optionally converted to a quarternary ammonium complex either partly or fully using the 'N' of the alpha amino acid group with nutritionally relevant anion radical.
- a quarternary ammonium complex either partly or fully using the 'N' of the alpha amino acid group with nutritionally relevant anion radical.
- the position of a peak due to formation of quarternary ammonium ion(s) vary depending upon the metal ion linked to the alpha amino acid.
- the present invention includes compositions and methods of manufacturing metal amino acid chelates having nutritionally relevant anion radical(s) as structured below.
- a metal alpha amino acid chelate having a nutritionally relevant anion radicals having a nutritionally relevant anion radicals
- 'R' is hydrogen, alkyl, aryl, alkoxy, arylalkoxy, a side chain having branches or ring structure optionally with an heteroatoms such as Sulphur, Nitrogen, Halo, etc or a peptide group;
- 'X' is a nutritionally relevant anion radical linked to the 'N' of the quarternary ammonium group of the alpha amino acid(s);
- 'a' is a numerical number that satisfies the valency of the metal 'M'and the amino acid(s) bonded to the Metal which totally satisfies the valency on the metal thus forming a chelate;
- 'b' defines an integer to obtain the electrical charge created by the formation of quarternary ammonium complex ion which can be 1 to a;
- 'e' is the number of nutritionally relevant anion radical and an electrical equivalent to nullify the charge 'b';
- 'M' is either metal atom or a metal ion having the positive charge "a" ranging from +1 to +6 preferably +2 to +4;
- Amino acid(s) used for chelation may be the same, different or in a combination thereof;
- the dotted line between 'N' of amino acid and the metal represents a weak bond, formed due to delocalization of a lone pair of electrons present on the carboxylic oxygen of the amino acid thus forming a five membered ring with the metal ion.
- R, M, X, a,b and e are the same as in structure 1.
- Y is an element or a group having ionic charge "d" which can be 1 to 4 for example Cl “1 , SO 4 "2 , H 2 PO 4 "1 , HPO 4 "2 , NO 3 "1 , HSeO 3 "1 etc.
- Metal amino acid chelate” or “amino acid chelate” shall include metal ions bonded to amino acids forming heterocyclic rings. The bonds may be coordinate covalent, covalent, and/or ionic at the carboxyl oxygen group. However, at the .alpha.-amino group, the bond is typically a coordinate ' covalent bond.
- Preferred amino acids include all of the naturally occurring amino acids. Additionally, for purposes of the present invention, "amino acid chelate” shall further include any charged amino acid chelate that is electrically balanced by a acid counter ion/ions.
- Metal amino acid Hydroxide chelate and “Metal amino acid salt '0 chelate” includes any chelate where the metal is bonded to the amino acid and carries a positive charge with the negative charge ion being any conventionally known anions excluding Radicals formed from ionic dissociation of nutritionally relevant acids .Hydroxide, Chloride, Sulphate, Nitrate, Carbonate and bicarbonate radicals are a few examples of the 5 Anion forming the above chelates.
- Metals include nutritionally relevant metals that are known to be needed by living organisms, particularly plants and mammals, including humans. Metals such as copper (Cu), zinc (Zn), iron (Fe),Calcium (Ca), cobalt (Co), magnesium (Mg), manganese (Mn), and/or chromium (Cr), among 0 others, are exemplary of nutritionally relevant metals.
- amino acid in the present invention is preferably one or more of the naturally occurring amino acid selected from the group consisting of alanine, arginine, asparagine, aspartic acid, cysteine, cystine, glutamine, glutamic acid, glycine, histidine, hydroxyproline, isoleucine, leucine, 5 lysine, methionine, ornithine, phenylalanine, proline, serine, threonine, tryptophan, tyrosine, valine, and combinations thereof.
- djpeptides, tripeptides, and tetrapeptides formed by any combination of the naturally occurring amino acids may also be used.
- "Nutritionally relevant acid radical” is meant to cover all radicals obtained by dissociation (including ionic) of the nutritionally relevant acid or it's salts & esters.
- Acids includes acids and that are known to be 5 needed by living organisms particularly Humans, Animals (including
- Aquatic organisms /animals and Farming animals and mammals
- They could be directly necessary for an organism's anabolism/growth or they could be required to catalyze / synthesize other nutritive substances produced in the body of an organism (ex enzymes, I o Harmones etc) in turn necessary for the organism's anabolism / growth.
- Nicotinate from Nicotinic acid
- Citrate (from citric acid)
- Tartrate from tartaric acid
- Lactate (from lactic acid)
- chelates are prepared by reacting a metal amino acid salt chelate ° and a nutritionally relevant acid at a ratio sufficient to allow substantially all of the ions present in solution to react forming a positively charged metal amino acid chelate having the desired acid radical as the counter ion.
- the metal amino acid chelates of the present invention will have a amino acid to metal to acid radical molar ratio from about 1 :1:1 to 4:1:2.
- the present invention also reveals the process of manufacturing the alpha amino acid chelates having nutritionally relevant anion radical(s) as described above.
- a metal amino acid chelate having nutritionally relevant acid radical In order to manufacture a metal amino acid chelate having nutritionally relevant acid radical, it generally requires that the desired metal aminoacid Hydroxide chelate and desired acid both be dissolved in water/solvent.
- the acid releases an Hydrogen ion which reacts with the existing anion radical namely Hydroxide group of the metal amino acid chelate forming water.
- the acid group devoid of the Hydrogen ion links with the metal amino acid and forms a neutral chelate which when ionized has the metal Amino acid with the positive charge and the acid radical with the negative charge.
- composition can also be manufactured by reacting a metal Amino Acid salt chelate and a salt or ester of the desired acid.
- a metal Amino Acid salt chelate and a salt or ester of the desired acid.
- the chemistry of reaction is the same with the addition that a salt will also be formed as a byproduct.
- Reaction of Metal Amino Acid Hydroxide chelate with a salt or ester of desired acid will also give the desired composition with salt / alcohol as a byproduct.
Abstract
Description
Claims
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
IN226/MAS/2003 | 2003-03-19 | ||
IN226CH2003 | 2003-03-19 |
Publications (2)
Publication Number | Publication Date |
---|---|
WO2004082592A2 true WO2004082592A2 (en) | 2004-09-30 |
WO2004082592A3 WO2004082592A3 (en) | 2004-12-16 |
Family
ID=33017820
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/IN2004/000063 WO2004082592A2 (en) | 2003-03-19 | 2004-03-17 | Metal amino acid chelates having nutritionally relevant anion radical (s) |
Country Status (1)
Country | Link |
---|---|
WO (1) | WO2004082592A2 (en) |
Cited By (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN102258126A (en) * | 2011-08-19 | 2011-11-30 | 长沙微安生物科技有限公司 | Application of arginine chelates in animal feed additives |
CN101062913B (en) * | 2007-06-05 | 2013-01-23 | 重庆大学 | Preparation method of hydroxyproline-zinc chelate complex |
CN103772485A (en) * | 2014-01-23 | 2014-05-07 | 上海旭新化工科技有限公司 | Method for synthesizing L-alanyl-L-glutamine chromic salt |
EP3216782A4 (en) * | 2014-11-07 | 2018-07-18 | NPA - Núcleo De Pesquisas Aplicadas LTDA. | Iron amino acid compounds, method for preparing iron amino acid compounds, compositions containing iron amino acid compounds, and uses thereof |
Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5516925A (en) * | 1994-08-23 | 1996-05-14 | Albion International, Inc. | Amino acid chelates having improved palatability |
WO2003016332A2 (en) * | 2001-08-16 | 2003-02-27 | Albion International, Inc. | Enhancing solubility of iron amino acid chelates and iron proteinates |
-
2004
- 2004-03-17 WO PCT/IN2004/000063 patent/WO2004082592A2/en active Application Filing
Patent Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5516925A (en) * | 1994-08-23 | 1996-05-14 | Albion International, Inc. | Amino acid chelates having improved palatability |
WO2003016332A2 (en) * | 2001-08-16 | 2003-02-27 | Albion International, Inc. | Enhancing solubility of iron amino acid chelates and iron proteinates |
Cited By (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN101062913B (en) * | 2007-06-05 | 2013-01-23 | 重庆大学 | Preparation method of hydroxyproline-zinc chelate complex |
CN102258126A (en) * | 2011-08-19 | 2011-11-30 | 长沙微安生物科技有限公司 | Application of arginine chelates in animal feed additives |
CN103772485A (en) * | 2014-01-23 | 2014-05-07 | 上海旭新化工科技有限公司 | Method for synthesizing L-alanyl-L-glutamine chromic salt |
EP3216782A4 (en) * | 2014-11-07 | 2018-07-18 | NPA - Núcleo De Pesquisas Aplicadas LTDA. | Iron amino acid compounds, method for preparing iron amino acid compounds, compositions containing iron amino acid compounds, and uses thereof |
Also Published As
Publication number | Publication date |
---|---|
WO2004082592A3 (en) | 2004-12-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US6166071A (en) | Zinc amino acid chelates having ligands comprised of glycine and a sulfur-containing amino acids | |
CA2457584C (en) | Enhancing solubility of iron amino acid chelates and iron proteinates | |
US5516925A (en) | Amino acid chelates having improved palatability | |
US6458981B1 (en) | Composition and method for preparing amino acid chelate hydroxides free of interfering ions | |
CA2142358C (en) | .pi.-bond aromatic vitamin chelates | |
US6207204B1 (en) | Cereal grain kernels fortified with amino acid chelates and method of making | |
AU2003223768B2 (en) | Novel chromium (III) alpha amino acid complexes | |
EP2717713B1 (en) | Mixed amino acid metal salt complexes | |
US6407138B1 (en) | Composition and method for preparing electrically neutral amino acid chelates free of interfering ions | |
WO2007136727A2 (en) | Iron (ii) amino acid chelates with reducing agents attached thereto | |
US20090182044A1 (en) | Nitrate amino acid chelates | |
EP1737474A2 (en) | Non-gmo metal amino acid chelates and non-gmo metal amino acid chelate-containing compositions | |
WO2005105112A2 (en) | Hypoallergenic metal amino acid chelates and metal amino acid chelate-containing compositions | |
US7341708B1 (en) | Methods for producing pure amino acid chelate complexes, and uses thereof | |
WO2004082592A2 (en) | Metal amino acid chelates having nutritionally relevant anion radical (s) | |
Shah | Chelating agents and biovailability of minerals | |
WO2008034238A1 (en) | Methods for producing pure amino acid chelate complexes, and uses thereof | |
US7910137B2 (en) | Metal carnitine chelates | |
US20060013892A1 (en) | Administration of amino acid chelates for reduction in alcohol dependency | |
US20030158171A1 (en) | Chelates and complexes for reduction in alcohol dependency | |
US20020177584A1 (en) | Single pot process for preparing metal picolinates from alpha pecoline | |
EP2204099A1 (en) | Methods for producing pure amino acid chelate complexes, and uses thereof |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
AK | Designated states |
Kind code of ref document: A2 Designated state(s): AE AG AL AM AT AU AZ BA BB BG BR BW BY BZ CA CH CN CO CR CU CZ DE DK DM DZ EC EE EG ES FI GB GD GE GH GM HR HU ID IL IN IS JP KE KG KP KR KZ LC LK LR LS LT LU LV MA MD MG MK MN MW MX MZ NA NI NO NZ OM PG PH PL PT RO RU SC SD SE SG SK SL SY TJ TM TN TR TT TZ UA UG US UZ VC VN YU ZA ZM ZW |
|
AL | Designated countries for regional patents |
Kind code of ref document: A2 Designated state(s): BW GH GM KE LS MW MZ SD SL SZ TZ UG ZM ZW AM AZ BY KG KZ MD RU TJ TM AT BE BG CH CY CZ DE DK EE ES FI FR GB GR HU IE IT LU MC NL PL PT RO SE SI SK TR BF BJ CF CG CI CM GA GN GQ GW ML MR NE SN TD TG |
|
121 | Ep: the epo has been informed by wipo that ep was designated in this application | ||
WWE | Wipo information: entry into national phase |
Ref document number: 880/CHENP/2005 Country of ref document: IN |
|
122 | Ep: pct application non-entry in european phase |