USD86947S - Design fob a toy sand pail - Google Patents

Design fob a toy sand pail Download PDF

Info

Application number

Other languages

Inventor

Antonio Barone

Filing date

1932-03-19

Publication date

1932-05-17

239000004576 sand Substances 0.000 title description 6
DJGAAPFSPWAYTJ-UHFFFAOYSA-M metamizole sodium Chemical compound [Na+].O=C1C(N(CS([O-])(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 DJGAAPFSPWAYTJ-UHFFFAOYSA-M 0.000 description 2

Publication	Publication Date	Title
USD86947S (en)	1932-05-17	Design fob a toy sand pail
USD87612S (en)	1932-08-16	Design fob
USD86885S (en)	1932-05-03	Design fob a shakes tbay
USD90258S (en)	1933-07-04	Charles miller
USD88906S (en)	1933-01-03	Design fob a game board
USD86926S (en)	1932-05-10	Chaeles milleb
USD86129S (en)	1932-02-02	Design fob a box
USD90628S (en)	1933-09-05	Design fob a shoe
USD84773S (en)	1931-07-28	Design fob a game boakd
USD93861S (en)	1934-11-13	Design fob a shoe
USD87280S (en)	1932-06-28	Design fob a king ob similab abticle
USD90528S (en)	1933-08-22	Design for a clasp
USD88313S (en)	1932-11-15	Charles miller
USD93581S (en)	1934-10-09	Design fob a shoe
USD89052S (en)	1933-01-17	Design fob a shoe
USD93161S (en)	1934-08-28	Design fob a shoe
USD94239S (en)	1935-01-01	Design fob a shoe
USD87435S (en)	1932-07-26	Design fob a clasp
USD92860S (en)	1934-07-24	Design fob a shoe
USD94244S (en)	1935-01-01	Design fob a shoe
USD84189S (en)	1931-05-19	Abraham sttderov
USD90267S (en)	1933-07-04	Design fob a combined lighter and tobacco container or the like
USD66768S (en)	1925-03-10	Design fob a flower basket
USD100325S (en)	1936-07-07	Design for a shoe or similar article
USD94240S (en)	1935-01-01	Design fob a shoe